About N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine
N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine (PubChem CID 64862857) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine.
Molecular Properties
| Compound Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine |
| PubChem CID | 64862857 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine |
| SMILES | CCN1CCCC(NC2C3CCCOC3C2(C)C)C1 |
| InChI | InChI=1S/C16H30N2O/c1-4-18-9-5-7-12(11-18)17-14-13-8-6-10-19-15(13)16(14,2)3/h12-15,17H,4-11H2,1-3H3 |
| InChIKey | UQQFTUWAJQCMJM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine?
The IUPAC name of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine (CID 64862857) is N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine.
What is the SMILES notation for N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine?
The canonical SMILES for N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine is CCN1CCCC(NC2C3CCCOC3C2(C)C)C1.
What is the InChIKey of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine?
The InChIKey is UQQFTUWAJQCMJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O/c1-4-18-9-5-7-12(11-18)17-14-13-8-6-10-19-15(13)16(14,2)3/h12-15,17H,4-11H2,1-3H3.
What are the key properties of N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine?
N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine has a molecular weight of 266.43 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)-1-ethylpiperidin-3-amine is sourced from PubChem (CID 64862857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).