About 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one
5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one (PubChem CID 64862879) has the molecular formula C14H24N2O2
and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one |
| PubChem CID | 64862879 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one |
| SMILES | CC1(C)C(NCC2CCC(=O)N2)C2CCCOC21 |
| InChI | InChI=1S/C14H24N2O2/c1-14(2)12(10-4-3-7-18-13(10)14)15-8-9-5-6-11(17)16-9/h9-10,12-13,15H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | VSQWSXAVPBHCIT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one?
The IUPAC name of 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one (CID 64862879) is 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one?
The canonical SMILES for 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one is CC1(C)C(NCC2CCC(=O)N2)C2CCCOC21.
What is the InChIKey of 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one?
The InChIKey is VSQWSXAVPBHCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O2/c1-14(2)12(10-4-3-7-18-13(10)14)15-8-9-5-6-11(17)16-9/h9-10,12-13,15H,3-8H2,1-2H3,(H,16,17).
What are the key properties of 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one?
5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one has a molecular weight of 252.36 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]methyl]pyrrolidin-2-one is sourced from PubChem (CID 64862879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).