About N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine (PubChem CID 64862921) has the molecular formula C14H26N2O3S
and a molecular weight of 302.44 g/mol. Its IUPAC name is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine |
| PubChem CID | 64862921 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine |
| SMILES | CC1(C)C(NC2CCN(S(C)(=O)=O)CC2)C2CCOC21 |
| InChI | InChI=1S/C14H26N2O3S/c1-14(2)12(11-6-9-19-13(11)14)15-10-4-7-16(8-5-10)20(3,17)18/h10-13,15H,4-9H2,1-3H3 |
| InChIKey | BHFDQLRSDJLTEO-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine?
The IUPAC name of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine (CID 64862921) is N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine.
What is the SMILES notation for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine?
The canonical SMILES for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine is CC1(C)C(NC2CCN(S(C)(=O)=O)CC2)C2CCOC21.
What is the InChIKey of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine?
The InChIKey is BHFDQLRSDJLTEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O3S/c1-14(2)12(11-6-9-19-13(11)14)15-10-4-7-16(8-5-10)20(3,17)18/h10-13,15H,4-9H2,1-3H3.
What are the key properties of N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine?
N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine has a molecular weight of 302.44 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-1-methylsulfonylpiperidin-4-amine is sourced from PubChem (CID 64862921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).