About N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine
N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine (PubChem CID 64862941) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine |
| PubChem CID | 64862941 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine |
| SMILES | CC1(C)C(NCCN)C2CCOC21 |
| InChI | InChI=1S/C10H20N2O/c1-10(2)8(12-5-4-11)7-3-6-13-9(7)10/h7-9,12H,3-6,11H2,1-2H3 |
| InChIKey | YSMMMGUVFAFNFC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine?
The IUPAC name of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine (CID 64862941) is N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine is CC1(C)C(NCCN)C2CCOC21.
What is the InChIKey of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine?
The InChIKey is YSMMMGUVFAFNFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-10(2)8(12-5-4-11)7-3-6-13-9(7)10/h7-9,12H,3-6,11H2,1-2H3.
What are the key properties of N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine?
N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine has a molecular weight of 184.28 g/mol, XLogP of 0.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)ethane-1,2-diamine is sourced from PubChem (CID 64862941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).