About 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide
2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide (PubChem CID 64863119) has the molecular formula C16H29N3O2
and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide |
| PubChem CID | 64863119 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide |
| SMILES | CNC(=O)CN1CCC(NC2C3CCOC3C2(C)C)CC1 |
| InChI | InChI=1S/C16H29N3O2/c1-16(2)14(12-6-9-21-15(12)16)18-11-4-7-19(8-5-11)10-13(20)17-3/h11-12,14-15,18H,4-10H2,1-3H3,(H,17,20) |
| InChIKey | NSXLUVIXLOVMFG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide?
The IUPAC name of 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide (CID 64863119) is 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide.
What is the SMILES notation for 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide?
The canonical SMILES for 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide is CNC(=O)CN1CCC(NC2C3CCOC3C2(C)C)CC1.
What is the InChIKey of 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide?
The InChIKey is NSXLUVIXLOVMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N3O2/c1-16(2)14(12-6-9-21-15(12)16)18-11-4-7-19(8-5-11)10-13(20)17-3/h11-12,14-15,18H,4-10H2,1-3H3,(H,17,20).
What are the key properties of 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide?
2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide has a molecular weight of 295.43 g/mol, XLogP of 0.60, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)amino]piperidin-1-yl]-N-methylacetamide is sourced from PubChem (CID 64863119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).