C12H17F3N2O3S — CID 64863209
2-[5-propan-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-yl]sulfanylacetic acid (PubChem CID 64863209) has the molecular formula C12H17F3N2O3S and a molecular weight of 326.34 g/mol. Its IUPAC name is 2-[5-propan-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-propan-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 64863209 |
| Molecular Formula | C12H17F3N2O3S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[5-propan-2-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-2-yl]sulfanylacetic acid |
| SMILES | CC(C)c1cnc(SCC(=O)O)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O3S/c1-8(2)9-5-16-11(21-6-10(18)19)17(9)3-4-20-7-12(13,14)15/h5,8H,3-4,6-7H2,1-2H3,(H,18,19) |
| InChIKey | MDPRNOIRLGOPBC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|