About 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one
1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one (PubChem CID 64863436) has the molecular formula C16H28N2O2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one |
| PubChem CID | 64863436 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one |
| SMILES | CC(CN1CCCC1=O)NC1C2CCCOC2C1(C)C |
| InChI | InChI=1S/C16H28N2O2/c1-11(10-18-8-4-7-13(18)19)17-14-12-6-5-9-20-15(12)16(14,2)3/h11-12,14-15,17H,4-10H2,1-3H3 |
| InChIKey | QIMLMGRRDRWOJU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one?
The IUPAC name of 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one (CID 64863436) is 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one?
The canonical SMILES for 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one is CC(CN1CCCC1=O)NC1C2CCCOC2C1(C)C.
What is the InChIKey of 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one?
The InChIKey is QIMLMGRRDRWOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2O2/c1-11(10-18-8-4-7-13(18)19)17-14-12-6-5-9-20-15(12)16(14,2)3/h11-12,14-15,17H,4-10H2,1-3H3.
What are the key properties of 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one?
1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one has a molecular weight of 280.41 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(8,8-dimethyl-2-oxabicyclo[4.2.0]octan-7-yl)amino]propyl]pyrrolidin-2-one is sourced from PubChem (CID 64863436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).