C19H20N2O3S — CID 6486356
1-[(4-ethenylphenyl)methyl]-3-(3-methoxypropyl)thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 6486356) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1-[(4-ethenylphenyl)methyl]-3-(3-methoxypropyl)thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 1-[(4-ethenylphenyl)methyl]-3-(3-methoxypropyl)thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 6486356 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1-[(4-ethenylphenyl)methyl]-3-(3-methoxypropyl)thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | C=Cc1ccc(Cn2c(=O)n(CCCOC)c(=O)c3sccc32)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-3-14-5-7-15(8-6-14)13-21-16-9-12-25-17(16)18(22)20(19(21)23)10-4-11-24-2/h3,5-9,12H,1,4,10-11,13H2,2H3 |
| InChIKey | HCUWIOOQAVWBQF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|