About N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine
N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine (PubChem CID 64863720) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine |
| PubChem CID | 64863720 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine |
| SMILES | CN(CCNC1C2CCOC2C1(C)C)C1CC1 |
| InChI | InChI=1S/C14H26N2O/c1-14(2)12(11-6-9-17-13(11)14)15-7-8-16(3)10-4-5-10/h10-13,15H,4-9H2,1-3H3 |
| InChIKey | SVLYLETWBRNVDS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine?
The IUPAC name of N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine (CID 64863720) is N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine.
What is the SMILES notation for N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine?
The canonical SMILES for N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine is CN(CCNC1C2CCOC2C1(C)C)C1CC1.
What is the InChIKey of N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine?
The InChIKey is SVLYLETWBRNVDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O/c1-14(2)12(11-6-9-17-13(11)14)15-7-8-16(3)10-4-5-10/h10-13,15H,4-9H2,1-3H3.
What are the key properties of N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine?
N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine has a molecular weight of 238.37 g/mol, XLogP of 1.48, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopropyl-N-(7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-N'-methylethane-1,2-diamine is sourced from PubChem (CID 64863720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).