C14H24N2S — CID 64864536
3-(4,4-dimethylcyclohexyl)-4-propan-2-yl-1H-imidazole-2-thione (PubChem CID 64864536) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 3-(4,4-dimethylcyclohexyl)-4-propan-2-yl-1H-imidazole-2-thione.
| Compound Name | 3-(4,4-dimethylcyclohexyl)-4-propan-2-yl-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 64864536 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 3-(4,4-dimethylcyclohexyl)-4-propan-2-yl-1H-imidazole-2-thione |
| SMILES | CC(C)c1c[nH]c(=S)n1C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H24N2S/c1-10(2)12-9-15-13(17)16(12)11-5-7-14(3,4)8-6-11/h9-11H,5-8H2,1-4H3,(H,15,17) |
| InChIKey | WLCVQJMZQJFJOD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|