About 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol
2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol (PubChem CID 6486630) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol.
Molecular Properties
| Compound Name | 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol |
| PubChem CID | 6486630 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol |
| SMILES | CCC(CO)NC1CC(C)N(C)CC1C |
| InChI | InChI=1S/C12H26N2O/c1-5-11(8-15)13-12-6-10(3)14(4)7-9(12)2/h9-13,15H,5-8H2,1-4H3 |
| InChIKey | DIQREXVGAWIWBR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol?
The IUPAC name of 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol (CID 6486630) is 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol.
What is the SMILES notation for 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol?
The canonical SMILES for 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol is CCC(CO)NC1CC(C)N(C)CC1C.
What is the InChIKey of 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol?
The InChIKey is DIQREXVGAWIWBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-5-11(8-15)13-12-6-10(3)14(4)7-9(12)2/h9-13,15H,5-8H2,1-4H3.
What are the key properties of 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol?
2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol has a molecular weight of 214.35 g/mol, XLogP of 1.08, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1,2,5-trimethylpiperidin-4-yl)amino]butan-1-ol is sourced from PubChem (CID 6486630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).