C13H20FN — CID 64866859
N-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpropan-1-amine (PubChem CID 64866859) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpropan-1-amine.
| Compound Name | N-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 64866859 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | N-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methylpropan-1-amine |
| SMILES | Cc1ccc(CCNCC(C)C)cc1F |
| InChI | InChI=1S/C13H20FN/c1-10(2)9-15-7-6-12-5-4-11(3)13(14)8-12/h4-5,8,10,15H,6-7,9H2,1-3H3 |
| InChIKey | VQDLDLRBNQXOSG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|