About 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one
6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one (PubChem CID 6486690) has the molecular formula C17H17Cl2NO3
and a molecular weight of 354.23 g/mol. Its IUPAC name is 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one.
Molecular Properties
| Compound Name | 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one |
| PubChem CID | 6486690 |
| Molecular Formula | C17H17Cl2NO3 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one |
| SMILES | CC1CCCC(C)N1C(=O)c1cc2cc(Cl)cc(Cl)c2oc1=O |
| InChI | InChI=1S/C17H17Cl2NO3/c1-9-4-3-5-10(2)20(9)16(21)13-7-11-6-12(18)8-14(19)15(11)23-17(13)22/h6-10H,3-5H2,1-2H3 |
| InChIKey | FAHWTOURIJINNN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one?
The IUPAC name of 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one (CID 6486690) is 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one.
What is the SMILES notation for 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one?
The canonical SMILES for 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one is CC1CCCC(C)N1C(=O)c1cc2cc(Cl)cc(Cl)c2oc1=O.
What is the InChIKey of 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one?
The InChIKey is FAHWTOURIJINNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl2NO3/c1-9-4-3-5-10(2)20(9)16(21)13-7-11-6-12(18)8-14(19)15(11)23-17(13)22/h6-10H,3-5H2,1-2H3.
What are the key properties of 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one?
6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one has a molecular weight of 354.23 g/mol, XLogP of 4.50, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dichloro-3-(2,6-dimethylpiperidine-1-carbonyl)chromen-2-one is sourced from PubChem (CID 6486690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).