C12H23NO3S — CID 64867215
N-[(1-hydroxycyclohexyl)methyl]-2-(2-methoxyethylsulfanyl)acetamide (PubChem CID 64867215) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N-[(1-hydroxycyclohexyl)methyl]-2-(2-methoxyethylsulfanyl)acetamide.
| Compound Name | N-[(1-hydroxycyclohexyl)methyl]-2-(2-methoxyethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 64867215 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | N-[(1-hydroxycyclohexyl)methyl]-2-(2-methoxyethylsulfanyl)acetamide |
| SMILES | COCCSCC(=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C12H23NO3S/c1-16-7-8-17-9-11(14)13-10-12(15)5-3-2-4-6-12/h15H,2-10H2,1H3,(H,13,14) |
| InChIKey | VVMPGZZYZPMFGK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|