C13H15N3O3 — CID 64868082
6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 64868082) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is 6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 64868082 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 6-[hydroxy(pyrrolidin-2-yl)methyl]-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(C(O)C3CCCN3)cc2[nH]c1=O |
| InChI | InChI=1S/C13H15N3O3/c17-11(9-2-1-5-14-9)7-3-4-8-10(6-7)16-13(19)12(18)15-8/h3-4,6,9,11,14,17H,1-2,5H2,(H,15,18)(H,16,19) |
| InChIKey | UYWXUXZAPWRMCD-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|