C13H19NOS — CID 64868203
2-[cyclopropyl(thiophen-2-ylmethyl)amino]pentan-3-one (PubChem CID 64868203) has the molecular formula C13H19NOS and a molecular weight of 237.37 g/mol. Its IUPAC name is 2-[cyclopropyl(thiophen-2-ylmethyl)amino]pentan-3-one.
| Compound Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]pentan-3-one |
|---|---|
| PubChem CID | 64868203 |
| Molecular Formula | C13H19NOS |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[cyclopropyl(thiophen-2-ylmethyl)amino]pentan-3-one |
| SMILES | CCC(=O)C(C)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C13H19NOS/c1-3-13(15)10(2)14(11-6-7-11)9-12-5-4-8-16-12/h4-5,8,10-11H,3,6-7,9H2,1-2H3 |
| InChIKey | VGZMTCPZGZGMCM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |