C8H18N4O — CID 64868802
N'-amino-2,2,6-trimethylmorpholine-4-carboximidamide (PubChem CID 64868802) has the molecular formula C8H18N4O and a molecular weight of 186.26 g/mol. Its IUPAC name is N'-amino-2,2,6-trimethylmorpholine-4-carboximidamide.
| Compound Name | N'-amino-2,2,6-trimethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 64868802 |
| Molecular Formula | C8H18N4O |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.15 |
| IUPAC Name | N'-amino-2,2,6-trimethylmorpholine-4-carboximidamide |
| SMILES | CC1CN(/C(N)=N/N)CC(C)(C)O1 |
| InChI | InChI=1S/C8H18N4O/c1-6-4-12(7(9)11-10)5-8(2,3)13-6/h6H,4-5,10H2,1-3H3,(H2,9,11) |
| InChIKey | AFEGPBFJBQBAJI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|