C10H16N4O — CID 64869053
1-amino-2-[2-(3-methylphenoxy)ethyl]guanidine (PubChem CID 64869053) has the molecular formula C10H16N4O and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-amino-2-[2-(3-methylphenoxy)ethyl]guanidine.
| Compound Name | 1-amino-2-[2-(3-methylphenoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 64869053 |
| Molecular Formula | C10H16N4O |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-amino-2-[2-(3-methylphenoxy)ethyl]guanidine |
| SMILES | Cc1cccc(OCC/N=C(\N)NN)c1 |
| InChI | InChI=1S/C10H16N4O/c1-8-3-2-4-9(7-8)15-6-5-13-10(11)14-12/h2-4,7H,5-6,12H2,1H3,(H3,11,13,14) |
| InChIKey | SSKFKQIFOVSYGJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|