C14H22N2O4 — CID 64869169
3-(2,5-dioxopyrrolidin-1-yl)-N-[(1-hydroxycyclohexyl)methyl]propanamide (PubChem CID 64869169) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-[(1-hydroxycyclohexyl)methyl]propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[(1-hydroxycyclohexyl)methyl]propanamide |
|---|---|
| PubChem CID | 64869169 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-[(1-hydroxycyclohexyl)methyl]propanamide |
| SMILES | O=C(CCN1C(=O)CCC1=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C14H22N2O4/c17-11(6-9-16-12(18)4-5-13(16)19)15-10-14(20)7-2-1-3-8-14/h20H,1-10H2,(H,15,17) |
| InChIKey | OTTGTHHBTSUQPV-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|