About 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane
3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane (PubChem CID 64869288) has the molecular formula C12H22N4
and a molecular weight of 222.34 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane |
| PubChem CID | 64869288 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane |
| SMILES | CC1(C)CN(CCn2cccn2)CCCN1 |
| InChI | InChI=1S/C12H22N4/c1-12(2)11-15(7-3-5-13-12)9-10-16-8-4-6-14-16/h4,6,8,13H,3,5,7,9-11H2,1-2H3 |
| InChIKey | WITRZRJGLUEYSN-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane?
The IUPAC name of 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane (CID 64869288) is 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane.
What is the SMILES notation for 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane?
The canonical SMILES for 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane is CC1(C)CN(CCn2cccn2)CCCN1.
What is the InChIKey of 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane?
The InChIKey is WITRZRJGLUEYSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4/c1-12(2)11-15(7-3-5-13-12)9-10-16-8-4-6-14-16/h4,6,8,13H,3,5,7,9-11H2,1-2H3.
What are the key properties of 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane?
3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane has a molecular weight of 222.34 g/mol, XLogP of 0.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-1-(2-pyrazol-1-ylethyl)-1,4-diazepane is sourced from PubChem (CID 64869288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).