C16H23BrN2 — CID 64869301
10-[(4-bromophenyl)methyl]-6,10-diazaspiro[4.6]undecane (PubChem CID 64869301) has the molecular formula C16H23BrN2 and a molecular weight of 323.28 g/mol. Its IUPAC name is 10-[(4-bromophenyl)methyl]-6,10-diazaspiro[4.6]undecane.
| Compound Name | 10-[(4-bromophenyl)methyl]-6,10-diazaspiro[4.6]undecane |
|---|---|
| PubChem CID | 64869301 |
| Molecular Formula | C16H23BrN2 |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 10-[(4-bromophenyl)methyl]-6,10-diazaspiro[4.6]undecane |
| SMILES | Brc1ccc(CN2CCCNC3(CCCC3)C2)cc1 |
| InChI | InChI=1S/C16H23BrN2/c17-15-6-4-14(5-7-15)12-19-11-3-10-18-16(13-19)8-1-2-9-16/h4-7,18H,1-3,8-13H2 |
| InChIKey | WSAUMQIIKHJSFU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |