About 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane
3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane (PubChem CID 64869465) has the molecular formula C11H20F2N2
and a molecular weight of 218.29 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane |
| PubChem CID | 64869465 |
| Molecular Formula | C11H20F2N2 |
| Molecular Weight | 218.29 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane |
| SMILES | CC1CCNC(C2CC2)CN1CC(F)F |
| InChI | InChI=1S/C11H20F2N2/c1-8-4-5-14-10(9-2-3-9)6-15(8)7-11(12)13/h8-11,14H,2-7H2,1H3 |
| InChIKey | DLJISOGPHIIKGA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane?
The IUPAC name of 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane (CID 64869465) is 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane.
What is the SMILES notation for 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane?
The canonical SMILES for 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane is CC1CCNC(C2CC2)CN1CC(F)F.
What is the InChIKey of 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane?
The InChIKey is DLJISOGPHIIKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2/c1-8-4-5-14-10(9-2-3-9)6-15(8)7-11(12)13/h8-11,14H,2-7H2,1H3.
What are the key properties of 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane?
3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane has a molecular weight of 218.29 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-1-(2,2-difluoroethyl)-7-methyl-1,4-diazepane is sourced from PubChem (CID 64869465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).