C10H17F3N2 — CID 64869542
3-cyclopropyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane (PubChem CID 64869542) has the molecular formula C10H17F3N2 and a molecular weight of 222.25 g/mol. Its IUPAC name is 3-cyclopropyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane.
| Compound Name | 3-cyclopropyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64869542 |
| Molecular Formula | C10H17F3N2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 3-cyclopropyl-1-(2,2,2-trifluoroethyl)-1,4-diazepane |
| SMILES | FC(F)(F)CN1CCCNC(C2CC2)C1 |
| InChI | InChI=1S/C10H17F3N2/c11-10(12,13)7-15-5-1-4-14-9(6-15)8-2-3-8/h8-9,14H,1-7H2 |
| InChIKey | YHLYNSRAMABGIQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |