C11H24N2 — CID 64870092
1,3-dipropyl-1,4-diazepane (PubChem CID 64870092) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 1,3-dipropyl-1,4-diazepane.
| Compound Name | 1,3-dipropyl-1,4-diazepane |
|---|---|
| PubChem CID | 64870092 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1,3-dipropyl-1,4-diazepane |
| SMILES | CCCC1CN(CCC)CCCN1 |
| InChI | InChI=1S/C11H24N2/c1-3-6-11-10-13(8-4-2)9-5-7-12-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | SOOVPJKJISGLCY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |