C11H22F2N2 — CID 64870539
1-(2,2-difluoroethyl)-3,3-diethyl-1,4-diazepane (PubChem CID 64870539) has the molecular formula C11H22F2N2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3,3-diethyl-1,4-diazepane.
| Compound Name | 1-(2,2-difluoroethyl)-3,3-diethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64870539 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3,3-diethyl-1,4-diazepane |
| SMILES | CCC1(CC)CN(CC(F)F)CCCN1 |
| InChI | InChI=1S/C11H22F2N2/c1-3-11(4-2)9-15(8-10(12)13)7-5-6-14-11/h10,14H,3-9H2,1-2H3 |
| InChIKey | UTASETXNJQLWJZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |