C13H28N2 — CID 64871072
1-(3,3-dimethylbutyl)-3,3-dimethyl-1,4-diazepane (PubChem CID 64871072) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-(3,3-dimethylbutyl)-3,3-dimethyl-1,4-diazepane.
| Compound Name | 1-(3,3-dimethylbutyl)-3,3-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64871072 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-(3,3-dimethylbutyl)-3,3-dimethyl-1,4-diazepane |
| SMILES | CC(C)(C)CCN1CCCNC(C)(C)C1 |
| InChI | InChI=1S/C13H28N2/c1-12(2,3)7-10-15-9-6-8-14-13(4,5)11-15/h14H,6-11H2,1-5H3 |
| InChIKey | SVJKPOQCRAYBGA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |