C13H16N2O — CID 648713
3,3-dimethyl-1-prop-2-enyl-4H-quinoxalin-2-one (PubChem CID 648713) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 3,3-dimethyl-1-prop-2-enyl-4H-quinoxalin-2-one.
| Compound Name | 3,3-dimethyl-1-prop-2-enyl-4H-quinoxalin-2-one |
|---|---|
| PubChem CID | 648713 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 3,3-dimethyl-1-prop-2-enyl-4H-quinoxalin-2-one |
| SMILES | C=CCN1C(=O)C(C)(C)Nc2ccccc21 |
| InChI | InChI=1S/C13H16N2O/c1-4-9-15-11-8-6-5-7-10(11)14-13(2,3)12(15)16/h4-8,14H,1,9H2,2-3H3 |
| InChIKey | LDJIANHTUWGAIN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|