C9H20N2 — CID 64871378
7-methyl-1-propan-2-yl-1,4-diazepane (PubChem CID 64871378) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 7-methyl-1-propan-2-yl-1,4-diazepane.
| Compound Name | 7-methyl-1-propan-2-yl-1,4-diazepane |
|---|---|
| PubChem CID | 64871378 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 7-methyl-1-propan-2-yl-1,4-diazepane |
| SMILES | CC(C)N1CCNCCC1C |
| InChI | InChI=1S/C9H20N2/c1-8(2)11-7-6-10-5-4-9(11)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | RZCKHOANYGWPHP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |