C16H25ClN2 — CID 64871428
1-[(3-chlorophenyl)methyl]-3-ethyl-3,7-dimethyl-1,4-diazepane (PubChem CID 64871428) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-ethyl-3,7-dimethyl-1,4-diazepane.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-3,7-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 64871428 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-ethyl-3,7-dimethyl-1,4-diazepane |
| SMILES | CCC1(C)CN(Cc2cccc(Cl)c2)C(C)CCN1 |
| InChI | InChI=1S/C16H25ClN2/c1-4-16(3)12-19(13(2)8-9-18-16)11-14-6-5-7-15(17)10-14/h5-7,10,13,18H,4,8-9,11-12H2,1-3H3 |
| InChIKey | RIRVNJPEXQBGGP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |