About 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane
3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane (PubChem CID 64871796) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane.
Molecular Properties
| Compound Name | 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane |
| PubChem CID | 64871796 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane |
| SMILES | CC(C)CCOCCN1CC(C)(C2CC2)NCCC1C |
| InChI | InChI=1S/C17H34N2O/c1-14(2)8-11-20-12-10-19-13-17(4,16-5-6-16)18-9-7-15(19)3/h14-16,18H,5-13H2,1-4H3 |
| InChIKey | ITIDEVAVBUBIJU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane?
The IUPAC name of 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane (CID 64871796) is 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane.
What is the SMILES notation for 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane?
The canonical SMILES for 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane is CC(C)CCOCCN1CC(C)(C2CC2)NCCC1C.
What is the InChIKey of 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane?
The InChIKey is ITIDEVAVBUBIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O/c1-14(2)8-11-20-12-10-19-13-17(4,16-5-6-16)18-9-7-15(19)3/h14-16,18H,5-13H2,1-4H3.
What are the key properties of 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane?
3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane has a molecular weight of 282.47 g/mol, XLogP of 2.90, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-3,7-dimethyl-1-[2-(3-methylbutoxy)ethyl]-1,4-diazepane is sourced from PubChem (CID 64871796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).