About 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane
3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane (PubChem CID 64871839) has the molecular formula C17H30N2S
and a molecular weight of 294.51 g/mol. Its IUPAC name is 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane |
| PubChem CID | 64871839 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane |
| SMILES | CCc1ccc(CN2CC(CC)(CC)NCCC2C)s1 |
| InChI | InChI=1S/C17H30N2S/c1-5-15-8-9-16(20-15)12-19-13-17(6-2,7-3)18-11-10-14(19)4/h8-9,14,18H,5-7,10-13H2,1-4H3 |
| InChIKey | YUUBTOOYCHLSAC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane?
The IUPAC name of 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane (CID 64871839) is 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane.
What is the SMILES notation for 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane?
The canonical SMILES for 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane is CCc1ccc(CN2CC(CC)(CC)NCCC2C)s1.
What is the InChIKey of 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane?
The InChIKey is YUUBTOOYCHLSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2S/c1-5-15-8-9-16(20-15)12-19-13-17(6-2,7-3)18-11-10-14(19)4/h8-9,14,18H,5-7,10-13H2,1-4H3.
What are the key properties of 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane?
3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane has a molecular weight of 294.51 g/mol, XLogP of 4.05, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-1-[(5-ethylthiophen-2-yl)methyl]-7-methyl-1,4-diazepane is sourced from PubChem (CID 64871839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).