About 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide
2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide (PubChem CID 648719) has the molecular formula C15H16N4O5S
and a molecular weight of 364.38 g/mol. Its IUPAC name is 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide |
| PubChem CID | 648719 |
| Molecular Formula | C15H16N4O5S |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CSC1=NC(=O)C(NC(C)=O)C(=O)N1 |
| InChI | InChI=1S/C15H16N4O5S/c1-8(20)16-12-13(22)18-15(19-14(12)23)25-7-11(21)17-9-5-3-4-6-10(9)24-2/h3-6,12H,7H2,1-2H3,(H,16,20)(H,17,21)(H,18,19,22,23) |
| InChIKey | FXHGLBOEFVELMK-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide?
The IUPAC name of 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide (CID 648719) is 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide.
What is the SMILES notation for 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide?
The canonical SMILES for 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide is COc1ccccc1NC(=O)CSC1=NC(=O)C(NC(C)=O)C(=O)N1.
What is the InChIKey of 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide?
The InChIKey is FXHGLBOEFVELMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N4O5S/c1-8(20)16-12-13(22)18-15(19-14(12)23)25-7-11(21)17-9-5-3-4-6-10(9)24-2/h3-6,12H,7H2,1-2H3,(H,16,20)(H,17,21)(H,18,19,22,23).
What are the key properties of 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide?
2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide has a molecular weight of 364.38 g/mol, XLogP of -0.12, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-acetamido-4,6-dioxo-1H-pyrimidin-2-yl)sulfanyl]-N-(2-methoxyphenyl)acetamide is sourced from PubChem (CID 648719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).