C8H11F3N2O3 — CID 64873258
1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione (PubChem CID 64873258) has the molecular formula C8H11F3N2O3 and a molecular weight of 240.18 g/mol. Its IUPAC name is 1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione.
| Compound Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64873258 |
| Molecular Formula | C8H11F3N2O3 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione |
| SMILES | O=C1CN(CCOCC(F)(F)F)C(=O)CN1 |
| InChI | InChI=1S/C8H11F3N2O3/c9-8(10,11)5-16-2-1-13-4-6(14)12-3-7(13)15/h1-5H2,(H,12,14) |
| InChIKey | MMUZOWJYGGRATJ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|