C14H26N2O2 — CID 64873577
6,6-dimethyl-1-pentyl-3-propylpiperazine-2,5-dione (PubChem CID 64873577) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 6,6-dimethyl-1-pentyl-3-propylpiperazine-2,5-dione.
| Compound Name | 6,6-dimethyl-1-pentyl-3-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64873577 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 6,6-dimethyl-1-pentyl-3-propylpiperazine-2,5-dione |
| SMILES | CCCCCN1C(=O)C(CCC)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H26N2O2/c1-5-7-8-10-16-12(17)11(9-6-2)15-13(18)14(16,3)4/h11H,5-10H2,1-4H3,(H,15,18) |
| InChIKey | IPZLOQGVRKGCQH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|