About 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione
6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione (PubChem CID 64873811) has the molecular formula C12H22N2O4S
and a molecular weight of 290.39 g/mol. Its IUPAC name is 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione |
| PubChem CID | 64873811 |
| Molecular Formula | C12H22N2O4S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione |
| SMILES | CCC1C(=O)NC(C)(C)C(=O)N1CCCS(C)(=O)=O |
| InChI | InChI=1S/C12H22N2O4S/c1-5-9-10(15)13-12(2,3)11(16)14(9)7-6-8-19(4,17)18/h9H,5-8H2,1-4H3,(H,13,15) |
| InChIKey | ZYDZLVNGKCKEAX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione?
The IUPAC name of 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione (CID 64873811) is 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione.
What is the SMILES notation for 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione?
The canonical SMILES for 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione is CCC1C(=O)NC(C)(C)C(=O)N1CCCS(C)(=O)=O.
What is the InChIKey of 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione?
The InChIKey is ZYDZLVNGKCKEAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O4S/c1-5-9-10(15)13-12(2,3)11(16)14(9)7-6-8-19(4,17)18/h9H,5-8H2,1-4H3,(H,13,15).
What are the key properties of 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione?
6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione has a molecular weight of 290.39 g/mol, XLogP of -0.06, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3,3-dimethyl-1-(3-methylsulfonylpropyl)piperazine-2,5-dione is sourced from PubChem (CID 64873811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).