C14H26N2O3 — CID 64873847
1-(2-butoxyethyl)-6-methyl-3-propan-2-ylpiperazine-2,5-dione (PubChem CID 64873847) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 1-(2-butoxyethyl)-6-methyl-3-propan-2-ylpiperazine-2,5-dione.
| Compound Name | 1-(2-butoxyethyl)-6-methyl-3-propan-2-ylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64873847 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 1-(2-butoxyethyl)-6-methyl-3-propan-2-ylpiperazine-2,5-dione |
| SMILES | CCCCOCCN1C(=O)C(C(C)C)NC(=O)C1C |
| InChI | InChI=1S/C14H26N2O3/c1-5-6-8-19-9-7-16-11(4)13(17)15-12(10(2)3)14(16)18/h10-12H,5-9H2,1-4H3,(H,15,17) |
| InChIKey | PLFKYRVXCUFYOZ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|