About 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione
6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione (PubChem CID 64873934) has the molecular formula C14H20N2O2S
and a molecular weight of 280.39 g/mol. Its IUPAC name is 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione |
| PubChem CID | 64873934 |
| Molecular Formula | C14H20N2O2S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione |
| SMILES | CC1NC(=O)C(C(C)(C)C)N(Cc2ccsc2)C1=O |
| InChI | InChI=1S/C14H20N2O2S/c1-9-13(18)16(7-10-5-6-19-8-10)11(12(17)15-9)14(2,3)4/h5-6,8-9,11H,7H2,1-4H3,(H,15,17) |
| InChIKey | MFVQRRAFXZAHTK-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione?
The IUPAC name of 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione (CID 64873934) is 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione.
What is the SMILES notation for 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione?
The canonical SMILES for 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione is CC1NC(=O)C(C(C)(C)C)N(Cc2ccsc2)C1=O.
What is the InChIKey of 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione?
The InChIKey is MFVQRRAFXZAHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2S/c1-9-13(18)16(7-10-5-6-19-8-10)11(12(17)15-9)14(2,3)4/h5-6,8-9,11H,7H2,1-4H3,(H,15,17).
What are the key properties of 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione?
6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione has a molecular weight of 280.39 g/mol, XLogP of 2.01, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-3-methyl-1-(thiophen-3-ylmethyl)piperazine-2,5-dione is sourced from PubChem (CID 64873934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).