C9H13F3N2O3 — CID 64874240
1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-2,5-dione (PubChem CID 64874240) has the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-2,5-dione.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64874240 |
| Molecular Formula | C9H13F3N2O3 |
| Molecular Weight | 254.21 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propyl]piperazine-2,5-dione |
| SMILES | O=C1CN(CCCOCC(F)(F)F)C(=O)CN1 |
| InChI | InChI=1S/C9H13F3N2O3/c10-9(11,12)6-17-3-1-2-14-5-7(15)13-4-8(14)16/h1-6H2,(H,13,15) |
| InChIKey | ZWPOEWMNMSPNFV-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.21 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|