About 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine
5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine (PubChem CID 64875943) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine |
| PubChem CID | 64875943 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine |
| SMILES | CC(C)N1CC(C)(C2CC2)NCC1C |
| InChI | InChI=1S/C12H24N2/c1-9(2)14-8-12(4,11-5-6-11)13-7-10(14)3/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | VCOWXHGNIFPUDX-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine?
The IUPAC name of 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine (CID 64875943) is 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine.
What is the SMILES notation for 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine?
The canonical SMILES for 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine is CC(C)N1CC(C)(C2CC2)NCC1C.
What is the InChIKey of 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine?
The InChIKey is VCOWXHGNIFPUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-9(2)14-8-12(4,11-5-6-11)13-7-10(14)3/h9-11,13H,5-8H2,1-4H3.
What are the key properties of 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine?
5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine has a molecular weight of 196.34 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-2,5-dimethyl-1-propan-2-ylpiperazine is sourced from PubChem (CID 64875943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).