C7H8N2O2 — CID 6487595
2,4-dimethylpyrimidine-5-carboxylic acid (PubChem CID 6487595) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is 2,4-dimethylpyrimidine-5-carboxylic acid.
| Compound Name | 2,4-dimethylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 6487595 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 2,4-dimethylpyrimidine-5-carboxylic acid |
| SMILES | Cc1ncc(C(=O)O)c(C)n1 |
| InChI | InChI=1S/C7H8N2O2/c1-4-6(7(10)11)3-8-5(2)9-4/h3H,1-2H3,(H,10,11) |
| InChIKey | FEFGZJBHDQRFOS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |