About ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate
ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 6487597) has the molecular formula C9H8BrNO2S
and a molecular weight of 274.14 g/mol. Its IUPAC name is ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 6487597 |
| Molecular Formula | C9H8BrNO2S |
| Molecular Weight | 274.14 g/mol |
| Exact Mass | 272.95 |
| IUPAC Name | ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)c1cc2scc(Br)c2[nH]1 |
| InChI | InChI=1S/C9H8BrNO2S/c1-2-13-9(12)6-3-7-8(11-6)5(10)4-14-7/h3-4,11H,2H2,1H3 |
| InChIKey | KSONMHNRMJQMFE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.14 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate (CID 6487597) is ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate is CCOC(=O)c1cc2scc(Br)c2[nH]1.
What is the InChIKey of ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate?
The InChIKey is KSONMHNRMJQMFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrNO2S/c1-2-13-9(12)6-3-7-8(11-6)5(10)4-14-7/h3-4,11H,2H2,1H3.
What are the key properties of ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate?
ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate has a molecular weight of 274.14 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 6487597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).