About 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane
9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane (PubChem CID 64877176) has the molecular formula C18H28N2
and a molecular weight of 272.44 g/mol. Its IUPAC name is 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane |
| PubChem CID | 64877176 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCCC1CNC2(CCCC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C18H28N2/c1-2-8-17-13-19-18(11-6-7-12-18)15-20(17)14-16-9-4-3-5-10-16/h3-5,9-10,17,19H,2,6-8,11-15H2,1H3 |
| InChIKey | UDGNGSFDQVYBDA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane?
The IUPAC name of 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane (CID 64877176) is 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane is CCCC1CNC2(CCCC2)CN1Cc1ccccc1.
What is the InChIKey of 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane?
The InChIKey is UDGNGSFDQVYBDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2/c1-2-8-17-13-19-18(11-6-7-12-18)15-20(17)14-16-9-4-3-5-10-16/h3-5,9-10,17,19H,2,6-8,11-15H2,1H3.
What are the key properties of 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane?
9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane has a molecular weight of 272.44 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzyl-8-propyl-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 64877176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).