C17H27BrN2S — CID 64877308
1-[(4-bromothiophen-2-yl)methyl]-5-cyclopropyl-5-methyl-2-(2-methylpropyl)piperazine (PubChem CID 64877308) has the molecular formula C17H27BrN2S and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-[(4-bromothiophen-2-yl)methyl]-5-cyclopropyl-5-methyl-2-(2-methylpropyl)piperazine.
| Compound Name | 1-[(4-bromothiophen-2-yl)methyl]-5-cyclopropyl-5-methyl-2-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 64877308 |
| Molecular Formula | C17H27BrN2S |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-[(4-bromothiophen-2-yl)methyl]-5-cyclopropyl-5-methyl-2-(2-methylpropyl)piperazine |
| SMILES | CC(C)CC1CNC(C)(C2CC2)CN1Cc1cc(Br)cs1 |
| InChI | InChI=1S/C17H27BrN2S/c1-12(2)6-15-8-19-17(3,13-4-5-13)11-20(15)9-16-7-14(18)10-21-16/h7,10,12-13,15,19H,4-6,8-9,11H2,1-3H3 |
| InChIKey | XBVLDVHPRBCJTM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |