C18H25ClN2 — CID 64877376
9-[(4-chlorophenyl)methyl]-8-cyclopropyl-6,9-diazaspiro[4.5]decane (PubChem CID 64877376) has the molecular formula C18H25ClN2 and a molecular weight of 304.86 g/mol. Its IUPAC name is 9-[(4-chlorophenyl)methyl]-8-cyclopropyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 9-[(4-chlorophenyl)methyl]-8-cyclopropyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64877376 |
| Molecular Formula | C18H25ClN2 |
| Molecular Weight | 304.86 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 9-[(4-chlorophenyl)methyl]-8-cyclopropyl-6,9-diazaspiro[4.5]decane |
| SMILES | Clc1ccc(CN2CC3(CCCC3)NCC2C2CC2)cc1 |
| InChI | InChI=1S/C18H25ClN2/c19-16-7-3-14(4-8-16)12-21-13-18(9-1-2-10-18)20-11-17(21)15-5-6-15/h3-4,7-8,15,17,20H,1-2,5-6,9-13H2 |
| InChIKey | FEAHMJWXPNNCGF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.86 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |