C15H30N2O — CID 64878399
4-(2-ethoxyethyl)-3,3-dimethyl-1,4-diazaspiro[5.5]undecane (PubChem CID 64878399) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 4-(2-ethoxyethyl)-3,3-dimethyl-1,4-diazaspiro[5.5]undecane.
| Compound Name | 4-(2-ethoxyethyl)-3,3-dimethyl-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 64878399 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 4-(2-ethoxyethyl)-3,3-dimethyl-1,4-diazaspiro[5.5]undecane |
| SMILES | CCOCCN1CC2(CCCCC2)NCC1(C)C |
| InChI | InChI=1S/C15H30N2O/c1-4-18-11-10-17-13-15(8-6-5-7-9-15)16-12-14(17,2)3/h16H,4-13H2,1-3H3 |
| InChIKey | KTXRQWVEMUPXOL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|