About 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione
3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione (PubChem CID 64878866) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione.
Molecular Properties
| Compound Name | 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione |
| PubChem CID | 64878866 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione |
| SMILES | Cc1cc(C)cc(CN2CC(=O)NC(C(C)(C)C)C2=O)c1 |
| InChI | InChI=1S/C17H24N2O2/c1-11-6-12(2)8-13(7-11)9-19-10-14(20)18-15(16(19)21)17(3,4)5/h6-8,15H,9-10H2,1-5H3,(H,18,20) |
| InChIKey | ZYUMBVWQVNLQSZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione?
The IUPAC name of 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione (CID 64878866) is 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione.
What is the SMILES notation for 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione?
The canonical SMILES for 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione is Cc1cc(C)cc(CN2CC(=O)NC(C(C)(C)C)C2=O)c1.
What is the InChIKey of 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione?
The InChIKey is ZYUMBVWQVNLQSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-11-6-12(2)8-13(7-11)9-19-10-14(20)18-15(16(19)21)17(3,4)5/h6-8,15H,9-10H2,1-5H3,(H,18,20).
What are the key properties of 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione?
3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione has a molecular weight of 288.39 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-[(3,5-dimethylphenyl)methyl]piperazine-2,5-dione is sourced from PubChem (CID 64878866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).