About 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione
1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione (PubChem CID 64879072) has the molecular formula C22H24N2O2
and a molecular weight of 348.45 g/mol. Its IUPAC name is 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione.
Molecular Properties
| Compound Name | 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione |
| PubChem CID | 64879072 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione |
| SMILES | CC1(c2ccccc2)NC(=O)C(C)(C2CC2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C22H24N2O2/c1-21(17-11-7-4-8-12-17)20(26)24(15-16-9-5-3-6-10-16)22(2,18-13-14-18)19(25)23-21/h3-12,18H,13-15H2,1-2H3,(H,23,25) |
| InChIKey | IFEKWJSOFOGCMH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione?
The IUPAC name of 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione (CID 64879072) is 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione.
What is the SMILES notation for 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione?
The canonical SMILES for 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione is CC1(c2ccccc2)NC(=O)C(C)(C2CC2)N(Cc2ccccc2)C1=O.
What is the InChIKey of 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione?
The InChIKey is IFEKWJSOFOGCMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O2/c1-21(17-11-7-4-8-12-17)20(26)24(15-16-9-5-3-6-10-16)22(2,18-13-14-18)19(25)23-21/h3-12,18H,13-15H2,1-2H3,(H,23,25).
What are the key properties of 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione?
1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione has a molecular weight of 348.45 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-6-cyclopropyl-3,6-dimethyl-3-phenylpiperazine-2,5-dione is sourced from PubChem (CID 64879072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).