C13H19F3N2O3 — CID 64879382
4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazaspiro[5.5]undecane-2,5-dione (PubChem CID 64879382) has the molecular formula C13H19F3N2O3 and a molecular weight of 308.30 g/mol. Its IUPAC name is 4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 64879382 |
| Molecular Formula | C13H19F3N2O3 |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-[2-(2,2,2-trifluoroethoxy)ethyl]-1,4-diazaspiro[5.5]undecane-2,5-dione |
| SMILES | O=C1CN(CCOCC(F)(F)F)C(=O)C2(CCCCC2)N1 |
| InChI | InChI=1S/C13H19F3N2O3/c14-13(15,16)9-21-7-6-18-8-10(19)17-12(11(18)20)4-2-1-3-5-12/h1-9H2,(H,17,19) |
| InChIKey | ARTIMYOUPOKNSL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|