C10H15F3N2O3 — CID 64880047
6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione (PubChem CID 64880047) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione.
| Compound Name | 6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 64880047 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 6-ethyl-1-[2-(2,2,2-trifluoroethoxy)ethyl]piperazine-2,5-dione |
| SMILES | CCC1C(=O)NCC(=O)N1CCOCC(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O3/c1-2-7-9(17)14-5-8(16)15(7)3-4-18-6-10(11,12)13/h7H,2-6H2,1H3,(H,14,17) |
| InChIKey | OGXPYVLSLKSPAU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|