About 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione
6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione (PubChem CID 64880504) has the molecular formula C14H17N3O2
and a molecular weight of 259.31 g/mol. Its IUPAC name is 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
Molecular Properties
| Compound Name | 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| PubChem CID | 64880504 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione |
| SMILES | O=C1CNC(=O)C2(CCCC2)N1Cc1ccccn1 |
| InChI | InChI=1S/C14H17N3O2/c18-12-9-16-13(19)14(6-2-3-7-14)17(12)10-11-5-1-4-8-15-11/h1,4-5,8H,2-3,6-7,9-10H2,(H,16,19) |
| InChIKey | WZQIGZLHCWRCBF-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
The IUPAC name of 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione (CID 64880504) is 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione.
What is the SMILES notation for 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
The canonical SMILES for 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione is O=C1CNC(=O)C2(CCCC2)N1Cc1ccccn1.
What is the InChIKey of 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
The InChIKey is WZQIGZLHCWRCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2/c18-12-9-16-13(19)14(6-2-3-7-14)17(12)10-11-5-1-4-8-15-11/h1,4-5,8H,2-3,6-7,9-10H2,(H,16,19).
What are the key properties of 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione?
6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione has a molecular weight of 259.31 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(pyridin-2-ylmethyl)-6,9-diazaspiro[4.5]decane-7,10-dione is sourced from PubChem (CID 64880504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).